C26H24N4OS — CID 46322434
3-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-[(4-methylsulfanylphenyl)methyl]benzamide (PubChem CID 46322434) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-[(4-methylsulfanylphenyl)methyl]benzamide.
| Compound Name | 3-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-[(4-methylsulfanylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46322434 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-[(4-methylsulfanylphenyl)methyl]benzamide |
| SMILES | CSc1ccc(CNC(=O)c2cccc(Nc3ccc(-c4ccc(C)cc4)nn3)c2)cc1 |
| InChI | InChI=1S/C26H24N4OS/c1-18-6-10-20(11-7-18)24-14-15-25(30-29-24)28-22-5-3-4-21(16-22)26(31)27-17-19-8-12-23(32-2)13-9-19/h3-16H,17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | CNLHUFPGIHFKJP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |