C29H31N5O — CID 46320713
N-[[4-(diethylamino)phenyl]methyl]-4-[[6-(3-methylphenyl)pyridazin-3-yl]amino]benzamide (PubChem CID 46320713) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-4-[[6-(3-methylphenyl)pyridazin-3-yl]amino]benzamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-4-[[6-(3-methylphenyl)pyridazin-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 46320713 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-4-[[6-(3-methylphenyl)pyridazin-3-yl]amino]benzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2ccc(Nc3ccc(-c4cccc(C)c4)nn3)cc2)cc1 |
| InChI | InChI=1S/C29H31N5O/c1-4-34(5-2)26-15-9-22(10-16-26)20-30-29(35)23-11-13-25(14-12-23)31-28-18-17-27(32-33-28)24-8-6-7-21(3)19-24/h6-19H,4-5,20H2,1-3H3,(H,30,35)(H,31,33) |
| InChIKey | USESJQJLSKYBNR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|