C22H22N4O3 — CID 46323290
N-(3-benzamido-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 46323290) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(3-benzamido-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-(3-benzamido-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 46323290 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(3-benzamido-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2n[nH]c3c2CCCC3)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N4O3/c1-29-19-12-11-15(13-18(19)24-21(27)14-7-3-2-4-8-14)23-22(28)20-16-9-5-6-10-17(16)25-26-20/h2-4,7-8,11-13H,5-6,9-10H2,1H3,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | KWUJNMWXHKTYDP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |