C18H22N4O3 — CID 4230884
N'-[1-(3,4-dimethoxyphenyl)ethenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide (PubChem CID 4230884) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 4230884 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethenyl]-4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide |
| SMILES | C=C(NNC(=O)c1n[nH]c2c1CCCC2)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H22N4O3/c1-11(12-8-9-15(24-2)16(10-12)25-3)19-22-18(23)17-13-6-4-5-7-14(13)20-21-17/h8-10,19H,1,4-7H2,2-3H3,(H,20,21)(H,22,23) |
| InChIKey | SDOZPCSZQLSLQL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|