C20H25N3O3 — CID 125432821
N-[(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 125432821) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125432821 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@H](NC(=O)c1n[nH]c3c1CCCCC3)CC2 |
| InChI | InChI=1S/C20H25N3O3/c1-25-17-10-12-8-9-15(14(12)11-18(17)26-2)21-20(24)19-13-6-4-3-5-7-16(13)22-23-19/h10-11,15H,3-9H2,1-2H3,(H,21,24)(H,22,23)/t15-/m1/s1 |
| InChIKey | MUZLIGHGGMTUOO-OAHLLOKOSA-N |
| XLogP | 3.11 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |