C27H27N5O3 — CID 46324050
N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide (PubChem CID 46324050) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide.
| Compound Name | N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46324050 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide |
| SMILES | COc1ccc(Nc2nc(C)c(NC(=O)c3cccc(C)c3)c(Nc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-17-6-5-7-19(16-17)26(33)31-24-18(2)28-27(30-21-10-14-23(35-4)15-11-21)32-25(24)29-20-8-12-22(34-3)13-9-20/h5-16H,1-4H3,(H,31,33)(H2,28,29,30,32) |
| InChIKey | XTQMXILGNUJWFT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |