C24H25N5O2S — CID 46324732
N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]benzamide (PubChem CID 46324732) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]benzamide.
| Compound Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46324732 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]benzamide |
| SMILES | Cc1[nH]cnc1CSCCNC(=O)c1ccc(Cn2c(=O)c(C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H25N5O2S/c1-16-21(27-15-26-16)14-32-12-11-25-23(30)19-9-7-18(8-10-19)13-29-22-6-4-3-5-20(22)28-17(2)24(29)31/h3-10,15H,11-14H2,1-2H3,(H,25,30)(H,26,27) |
| InChIKey | YAKNXOPPCPVQQN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|