C22H29N3O3 — CID 46326852
6-(cyclopentanecarbonylamino)-2-(dipropylamino)quinoline-4-carboxylic acid (PubChem CID 46326852) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6-(cyclopentanecarbonylamino)-2-(dipropylamino)quinoline-4-carboxylic acid.
| Compound Name | 6-(cyclopentanecarbonylamino)-2-(dipropylamino)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 46326852 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 6-(cyclopentanecarbonylamino)-2-(dipropylamino)quinoline-4-carboxylic acid |
| SMILES | CCCN(CCC)c1cc(C(=O)O)c2cc(NC(=O)C3CCCC3)ccc2n1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-11-25(12-4-2)20-14-18(22(27)28)17-13-16(9-10-19(17)24-20)23-21(26)15-7-5-6-8-15/h9-10,13-15H,3-8,11-12H2,1-2H3,(H,23,26)(H,27,28) |
| InChIKey | VQCIXPSORUTQHY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |