C19H24ClN5O2S2 — CID 46327751
N-(4-chlorophenyl)-5-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]sulfanyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46327751) has the molecular formula C19H24ClN5O2S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]sulfanyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]sulfanyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46327751 |
| Molecular Formula | C19H24ClN5O2S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-(4-chlorophenyl)-5-[2-oxo-2-(3-piperidin-1-ylpropylamino)ethyl]sulfanyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(CSc1nnc(C(=O)Nc2ccc(Cl)cc2)s1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C19H24ClN5O2S2/c20-14-5-7-15(8-6-14)22-17(27)18-23-24-19(29-18)28-13-16(26)21-9-4-12-25-10-2-1-3-11-25/h5-8H,1-4,9-13H2,(H,21,26)(H,22,27) |
| InChIKey | DCWFIBAKNHCFLA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|