C20H26ClN5O2S2 — CID 46327925
5-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]sulfanyl-N-(3-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46327925) has the molecular formula C20H26ClN5O2S2 and a molecular weight of 468.05 g/mol. Its IUPAC name is 5-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]sulfanyl-N-(3-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]sulfanyl-N-(3-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46327925 |
| Molecular Formula | C20H26ClN5O2S2 |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 5-[2-[3-(azepan-1-yl)propylamino]-2-oxoethyl]sulfanyl-N-(3-chlorophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(CSc1nnc(C(=O)Nc2cccc(Cl)c2)s1)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C20H26ClN5O2S2/c21-15-7-5-8-16(13-15)23-18(28)19-24-25-20(30-19)29-14-17(27)22-9-6-12-26-10-3-1-2-4-11-26/h5,7-8,13H,1-4,6,9-12,14H2,(H,22,27)(H,23,28) |
| InChIKey | DVMXMLNTWWXGDL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|