C28H24ClN5O2 — CID 46328093
8-[[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]phenyl]methyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 46328093) has the molecular formula C28H24ClN5O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is 8-[[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]phenyl]methyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 8-[[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]phenyl]methyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 46328093 |
| Molecular Formula | C28H24ClN5O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 8-[[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]phenyl]methyl]-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | O=C(c1cccc(Cn2c(=O)c3cccn3c3cccnc32)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C28H24ClN5O2/c29-22-7-2-8-23(18-22)31-13-15-32(16-14-31)27(35)21-6-1-5-20(17-21)19-34-26-24(9-3-11-30-26)33-12-4-10-25(33)28(34)36/h1-12,17-18H,13-16,19H2 |
| InChIKey | KBAUQGSKERQDNF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |