C22H23N3O3S — CID 46328736
N-[5-[(2-phenoxyacetyl)amino]-1,3-benzothiazol-2-yl]cyclohexanecarboxamide (PubChem CID 46328736) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[5-[(2-phenoxyacetyl)amino]-1,3-benzothiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[5-[(2-phenoxyacetyl)amino]-1,3-benzothiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 46328736 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[5-[(2-phenoxyacetyl)amino]-1,3-benzothiazol-2-yl]cyclohexanecarboxamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc2sc(NC(=O)C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C22H23N3O3S/c26-20(14-28-17-9-5-2-6-10-17)23-16-11-12-19-18(13-16)24-22(29-19)25-21(27)15-7-3-1-4-8-15/h2,5-6,9-13,15H,1,3-4,7-8,14H2,(H,23,26)(H,24,25,27) |
| InChIKey | ZIZWAWUXFRVDGY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |