C21H20ClN3O2S — CID 46328690
3-chloro-N-[2-(cyclohexanecarbonylamino)-1,3-benzothiazol-5-yl]benzamide (PubChem CID 46328690) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 3-chloro-N-[2-(cyclohexanecarbonylamino)-1,3-benzothiazol-5-yl]benzamide.
| Compound Name | 3-chloro-N-[2-(cyclohexanecarbonylamino)-1,3-benzothiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 46328690 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-chloro-N-[2-(cyclohexanecarbonylamino)-1,3-benzothiazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2sc(NC(=O)C3CCCCC3)nc2c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O2S/c22-15-8-4-7-14(11-15)20(27)23-16-9-10-18-17(12-16)24-21(28-18)25-19(26)13-5-2-1-3-6-13/h4,7-13H,1-3,5-6H2,(H,23,27)(H,24,25,26) |
| InChIKey | ONGCOHVZCGMKQC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |