C18H17ClN4OS — CID 50881984
N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-3-chlorobenzamide (PubChem CID 50881984) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-3-chlorobenzamide.
| Compound Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 50881984 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-3-chlorobenzamide |
| SMILES | CC/C(C)=N\Nc1nc2cc(NC(=O)c3cccc(Cl)c3)ccc2s1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-3-11(2)22-23-18-21-15-10-14(7-8-16(15)25-18)20-17(24)12-5-4-6-13(19)9-12/h4-10H,3H2,1-2H3,(H,20,24)(H,21,23)/b22-11- |
| InChIKey | VXNBBORYKIOTDZ-JJFYIABZSA-N |
| XLogP | 5.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|