C16H12ClN3O2S — CID 46328625
N-(2-acetamido-1,3-benzothiazol-5-yl)-3-chlorobenzamide (PubChem CID 46328625) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-5-yl)-3-chlorobenzamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-5-yl)-3-chlorobenzamide |
|---|---|
| PubChem CID | 46328625 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-5-yl)-3-chlorobenzamide |
| SMILES | CC(=O)Nc1nc2cc(NC(=O)c3cccc(Cl)c3)ccc2s1 |
| InChI | InChI=1S/C16H12ClN3O2S/c1-9(21)18-16-20-13-8-12(5-6-14(13)23-16)19-15(22)10-3-2-4-11(17)7-10/h2-8H,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | CVVBFTARRMXOGO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |