C22H26N4OS — CID 50882033
N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide (PubChem CID 50882033) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide.
| Compound Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 50882033 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide |
| SMILES | CC/C(C)=N\Nc1nc2cc(NC(=O)c3ccc(C(C)(C)C)cc3)ccc2s1 |
| InChI | InChI=1S/C22H26N4OS/c1-6-14(2)25-26-21-24-18-13-17(11-12-19(18)28-21)23-20(27)15-7-9-16(10-8-15)22(3,4)5/h7-13H,6H2,1-5H3,(H,23,27)(H,24,26)/b25-14- |
| InChIKey | VYSNAVPDBRJBJC-QFEZKATASA-N |
| XLogP | 6.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|