C23H20N2OS — CID 46328992
N-benzyl-2-(2-phenylsulfanyl-1H-indol-3-yl)acetamide (PubChem CID 46328992) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is N-benzyl-2-(2-phenylsulfanyl-1H-indol-3-yl)acetamide.
| Compound Name | N-benzyl-2-(2-phenylsulfanyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46328992 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-benzyl-2-(2-phenylsulfanyl-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c(Sc2ccccc2)[nH]c2ccccc12)NCc1ccccc1 |
| InChI | InChI=1S/C23H20N2OS/c26-22(24-16-17-9-3-1-4-10-17)15-20-19-13-7-8-14-21(19)25-23(20)27-18-11-5-2-6-12-18/h1-14,25H,15-16H2,(H,24,26) |
| InChIKey | UKCOFHUKIXFXMO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |