C20H21FN2OS — CID 46379077
N-butan-2-yl-2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetamide (PubChem CID 46379077) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is N-butan-2-yl-2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 46379077 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-butan-2-yl-2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetamide |
| SMILES | CCC(C)NC(=O)Cc1c(Sc2cccc(F)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H21FN2OS/c1-3-13(2)22-19(24)12-17-16-9-4-5-10-18(16)23-20(17)25-15-8-6-7-14(21)11-15/h4-11,13,23H,3,12H2,1-2H3,(H,22,24) |
| InChIKey | JJLVRAXIOQMXOL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |