About N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide
N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 46331071) has the molecular formula C23H21FN4O3
and a molecular weight of 420.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| PubChem CID | 46331071 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(c2ccnc(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C23H21FN4O3/c24-17-3-1-2-16(12-17)22-25-9-6-21(27-22)28-10-7-15(8-11-28)23(29)26-18-4-5-19-20(13-18)31-14-30-19/h1-6,9,12-13,15H,7-8,10-11,14H2,(H,26,29) |
| InChIKey | KSGWWCDFBMYIHB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide (CID 46331071) is N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide is O=C(Nc1ccc2c(c1)OCO2)C1CCN(c2ccnc(-c3cccc(F)c3)n2)CC1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide?
The InChIKey is KSGWWCDFBMYIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FN4O3/c24-17-3-1-2-16(12-17)22-25-9-6-21(27-22)28-10-7-15(8-11-28)23(29)26-18-4-5-19-20(13-18)31-14-30-19/h1-6,9,12-13,15H,7-8,10-11,14H2,(H,26,29).
What are the key properties of N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide?
N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide has a molecular weight of 420.44 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-4-carboxamide is sourced from PubChem (CID 46331071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).