C26H28N4O3S — CID 46332708
N-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46332708) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46332708 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[4-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]-5-[(3-methylphenoxy)methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cc1cccc(OCc2nnc(C(=O)Nc3ccc(C(=O)NCCC4=CCCCC4)cc3)s2)c1 |
| InChI | InChI=1S/C26H28N4O3S/c1-18-6-5-9-22(16-18)33-17-23-29-30-26(34-23)25(32)28-21-12-10-20(11-13-21)24(31)27-15-14-19-7-3-2-4-8-19/h5-7,9-13,16H,2-4,8,14-15,17H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | RJDZMPYDLSSKRG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|