C23H29FN4O3S — CID 46333184
4-fluoro-N-[5-(3-methylpiperidine-1-carbonyl)-2-piperazin-1-ylphenyl]benzenesulfonamide (PubChem CID 46333184) has the molecular formula C23H29FN4O3S and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-fluoro-N-[5-(3-methylpiperidine-1-carbonyl)-2-piperazin-1-ylphenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[5-(3-methylpiperidine-1-carbonyl)-2-piperazin-1-ylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46333184 |
| Molecular Formula | C23H29FN4O3S |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 4-fluoro-N-[5-(3-methylpiperidine-1-carbonyl)-2-piperazin-1-ylphenyl]benzenesulfonamide |
| SMILES | CC1CCCN(C(=O)c2ccc(N3CCNCC3)c(NS(=O)(=O)c3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C23H29FN4O3S/c1-17-3-2-12-28(16-17)23(29)18-4-9-22(27-13-10-25-11-14-27)21(15-18)26-32(30,31)20-7-5-19(24)6-8-20/h4-9,15,17,25-26H,2-3,10-14,16H2,1H3 |
| InChIKey | NSWAEWGDLYQXCN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |