C19H20F2N2O3S — CID 109061537
N-(2,4-difluorophenyl)-4-(3-methylpiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 109061537) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(3-methylpiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(3-methylpiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 109061537 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(3-methylpiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CC1CCCN(C(=O)c2ccc(S(=O)(=O)Nc3ccc(F)cc3F)cc2)C1 |
| InChI | InChI=1S/C19H20F2N2O3S/c1-13-3-2-10-23(12-13)19(24)14-4-7-16(8-5-14)27(25,26)22-18-9-6-15(20)11-17(18)21/h4-9,11,13,22H,2-3,10,12H2,1H3 |
| InChIKey | KNCWZQVVJULYSG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |