C17H19N5O3S — CID 46337808
2-(furan-2-yl)-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 46337808) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 2-(furan-2-yl)-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 46337808 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-(furan-2-yl)-4-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]sulfanyl-6H-pyrazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | CC1CCN(C(=O)CSc2nc(-c3ccco3)nc3cc(=O)[nH]n23)CC1 |
| InChI | InChI=1S/C17H19N5O3S/c1-11-4-6-21(7-5-11)15(24)10-26-17-19-16(12-3-2-8-25-12)18-13-9-14(23)20-22(13)17/h2-3,8-9,11H,4-7,10H2,1H3,(H,20,23) |
| InChIKey | UQLHWQRYHYZSKR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|