C28H30N4O — CID 46338907
4-benzyl-2-(4-benzylpiperazin-1-yl)-1-(3-methylphenyl)-4H-imidazol-5-one (PubChem CID 46338907) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-benzyl-2-(4-benzylpiperazin-1-yl)-1-(3-methylphenyl)-4H-imidazol-5-one.
| Compound Name | 4-benzyl-2-(4-benzylpiperazin-1-yl)-1-(3-methylphenyl)-4H-imidazol-5-one |
|---|---|
| PubChem CID | 46338907 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 4-benzyl-2-(4-benzylpiperazin-1-yl)-1-(3-methylphenyl)-4H-imidazol-5-one |
| SMILES | Cc1cccc(N2C(=O)C(Cc3ccccc3)N=C2N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H30N4O/c1-22-9-8-14-25(19-22)32-27(33)26(20-23-10-4-2-5-11-23)29-28(32)31-17-15-30(16-18-31)21-24-12-6-3-7-13-24/h2-14,19,26H,15-18,20-21H2,1H3 |
| InChIKey | AGDRWXBFVQITCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |