C20H22N2OS — CID 46342493
N-(3-phenylpropyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide (PubChem CID 46342493) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide.
| Compound Name | N-(3-phenylpropyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 46342493 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(3-phenylpropyl)-3-pyrrol-1-yl-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CC(c1cccs1)n1cccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H22N2OS/c23-20(21-12-6-10-17-8-2-1-3-9-17)16-18(19-11-7-15-24-19)22-13-4-5-14-22/h1-5,7-9,11,13-15,18H,6,10,12,16H2,(H,21,23) |
| InChIKey | LFFYTQZFTUDKFI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|