C21H31N3O4S — CID 46344563
N-butyl-5-piperidin-1-ylsulfonyl-1-propanoyl-2,3-dihydroindole-2-carboxamide (PubChem CID 46344563) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-butyl-5-piperidin-1-ylsulfonyl-1-propanoyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | N-butyl-5-piperidin-1-ylsulfonyl-1-propanoyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 46344563 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-butyl-5-piperidin-1-ylsulfonyl-1-propanoyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCCCNC(=O)C1Cc2cc(S(=O)(=O)N3CCCCC3)ccc2N1C(=O)CC |
| InChI | InChI=1S/C21H31N3O4S/c1-3-5-11-22-21(26)19-15-16-14-17(9-10-18(16)24(19)20(25)4-2)29(27,28)23-12-7-6-8-13-23/h9-10,14,19H,3-8,11-13,15H2,1-2H3,(H,22,26) |
| InChIKey | AFFYMHGZCWLCMQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|