C21H31N3O5S — CID 20956463
1-acetyl-N-(3-propan-2-yloxypropyl)-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide (PubChem CID 20956463) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-acetyl-N-(3-propan-2-yloxypropyl)-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | 1-acetyl-N-(3-propan-2-yloxypropyl)-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 20956463 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-acetyl-N-(3-propan-2-yloxypropyl)-5-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)N3CCCC3)cc2CC1C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C21H31N3O5S/c1-15(2)29-12-6-9-22-21(26)20-14-17-13-18(7-8-19(17)24(20)16(3)25)30(27,28)23-10-4-5-11-23/h7-8,13,15,20H,4-6,9-12,14H2,1-3H3,(H,22,26) |
| InChIKey | QVZTYRXBKVXMJM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|