C33H25FN2O4S — CID 4634522
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4634522) has the molecular formula C33H25FN2O4S and a molecular weight of 564.64 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4634522 |
| Molecular Formula | C33H25FN2O4S |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(=O)C(=C(O)c4ccc(F)cc4)C3c3cccc(OCc4ccccc4)c3)sc2c1 |
| InChI | InChI=1S/C33H25FN2O4S/c1-19-15-20(2)28-26(16-19)41-33(35-28)36-29(23-9-6-10-25(17-23)40-18-21-7-4-3-5-8-21)27(31(38)32(36)39)30(37)22-11-13-24(34)14-12-22/h3-17,29,37H,18H2,1-2H3 |
| InChIKey | NJPRKOUCIOOCOL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|