C31H28FN5O — CID 46348074
N-(2,3-dimethylphenyl)-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 46348074) has the molecular formula C31H28FN5O and a molecular weight of 505.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46348074 |
| Molecular Formula | C31H28FN5O |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3C2c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C31H28FN5O/c1-20-9-7-12-27(21(20)2)33-31(38)36-19-26-22(3)34-37(25-10-5-4-6-11-25)30(26)35-18-8-13-28(35)29(36)23-14-16-24(32)17-15-23/h4-18,29H,19H2,1-3H3,(H,33,38) |
| InChIKey | FWQCQIQOLBZGFI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |