C33H33N5O — CID 92874196
(9R)-5-methyl-N-(2-methylphenyl)-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874196) has the molecular formula C33H33N5O and a molecular weight of 515.66 g/mol. Its IUPAC name is (9R)-5-methyl-N-(2-methylphenyl)-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-5-methyl-N-(2-methylphenyl)-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874196 |
| Molecular Formula | C33H33N5O |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (9R)-5-methyl-N-(2-methylphenyl)-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1Cc2c(C)nn(-c3ccccc3)c2-n2cccc2[C@H]1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C33H33N5O/c1-22(2)25-16-18-26(19-17-25)31-30-15-10-20-36(30)32-28(24(4)35-38(32)27-12-6-5-7-13-27)21-37(31)33(39)34-29-14-9-8-11-23(29)3/h5-20,22,31H,21H2,1-4H3,(H,34,39)/t31-/m1/s1 |
| InChIKey | ATJXSLHEUWWGDP-WJOKGBTCSA-N |
| XLogP | 7.54 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |