C34H35N5O — CID 92874204
(9R)-N-(2,4-dimethylphenyl)-5-methyl-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874204) has the molecular formula C34H35N5O and a molecular weight of 529.69 g/mol. Its IUPAC name is (9R)-N-(2,4-dimethylphenyl)-5-methyl-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-N-(2,4-dimethylphenyl)-5-methyl-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874204 |
| Molecular Formula | C34H35N5O |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (9R)-N-(2,4-dimethylphenyl)-5-methyl-3-phenyl-9-(4-propan-2-ylphenyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3[C@H]2c2ccc(C(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C34H35N5O/c1-22(2)26-14-16-27(17-15-26)32-31-12-9-19-37(31)33-29(25(5)36-39(33)28-10-7-6-8-11-28)21-38(32)34(40)35-30-18-13-23(3)20-24(30)4/h6-20,22,32H,21H2,1-5H3,(H,35,40)/t32-/m1/s1 |
| InChIKey | QQJHXPLNLHOLGZ-JGCGQSQUSA-N |
| XLogP | 7.85 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |