C31H29N5O — CID 92874243
(9S)-5-methyl-N,9-bis(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874243) has the molecular formula C31H29N5O and a molecular weight of 487.61 g/mol. Its IUPAC name is (9S)-5-methyl-N,9-bis(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-5-methyl-N,9-bis(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874243 |
| Molecular Formula | C31H29N5O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (9S)-5-methyl-N,9-bis(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3[C@@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H29N5O/c1-21-11-15-24(16-12-21)29-28-10-7-19-34(28)30-27(23(3)33-36(30)26-8-5-4-6-9-26)20-35(29)31(37)32-25-17-13-22(2)14-18-25/h4-19,29H,20H2,1-3H3,(H,32,37)/t29-/m0/s1 |
| InChIKey | QNHXPNQTZRRWNV-LJAQVGFWSA-N |
| XLogP | 6.73 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |