C31H29N5O3 — CID 92892385
(9S)-N,9-bis(4-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92892385) has the molecular formula C31H29N5O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is (9S)-N,9-bis(4-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-N,9-bis(4-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92892385 |
| Molecular Formula | C31H29N5O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (9S)-N,9-bis(4-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | COc1ccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H29N5O3/c1-21-27-20-35(31(37)32-23-13-17-26(39-3)18-14-23)29(22-11-15-25(38-2)16-12-22)28-10-7-19-34(28)30(27)36(33-21)24-8-5-4-6-9-24/h4-19,29H,20H2,1-3H3,(H,32,37)/t29-/m0/s1 |
| InChIKey | UWQWPXFYZYXKFY-LJAQVGFWSA-N |
| XLogP | 6.13 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |