C18H19N3O4S2 — CID 46349061
6-morpholin-4-ylsulfonyl-4-(pyridin-4-ylmethyl)-1,4-benzothiazin-3-one (PubChem CID 46349061) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-morpholin-4-ylsulfonyl-4-(pyridin-4-ylmethyl)-1,4-benzothiazin-3-one.
| Compound Name | 6-morpholin-4-ylsulfonyl-4-(pyridin-4-ylmethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46349061 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 6-morpholin-4-ylsulfonyl-4-(pyridin-4-ylmethyl)-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(S(=O)(=O)N3CCOCC3)cc2N1Cc1ccncc1 |
| InChI | InChI=1S/C18H19N3O4S2/c22-18-13-26-17-2-1-15(27(23,24)20-7-9-25-10-8-20)11-16(17)21(18)12-14-3-5-19-6-4-14/h1-6,11H,7-10,12-13H2 |
| InChIKey | IJCPSSSXRYXLMK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |