C12H15N3O3S — CID 46351373
N-(3-methoxyphenyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 46351373) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(3-methoxyphenyl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 46351373 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(3-methoxyphenyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2cn(C)c(C)n2)c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-9-13-12(8-15(9)2)19(16,17)14-10-5-4-6-11(7-10)18-3/h4-8,14H,1-3H3 |
| InChIKey | PGHBEKDXCKBEAT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |