C22H24N4O4S — CID 46353697
5-N-[(4-butoxyphenyl)methyl]-2-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2,5-dicarboxamide (PubChem CID 46353697) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 5-N-[(4-butoxyphenyl)methyl]-2-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2,5-dicarboxamide.
| Compound Name | 5-N-[(4-butoxyphenyl)methyl]-2-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 46353697 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 5-N-[(4-butoxyphenyl)methyl]-2-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2,5-dicarboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2nnc(C(=O)Nc3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-3-4-13-30-18-9-5-15(6-10-18)14-23-19(27)21-25-26-22(31-21)20(28)24-16-7-11-17(29-2)12-8-16/h5-12H,3-4,13-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | BLPAGDMHEQLOTC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|