C26H20N4O5 — CID 46356625
2-(1,3-dioxoisoindol-2-yl)-N-[4-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]acetamide (PubChem CID 46356625) has the molecular formula C26H20N4O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 46356625 |
| Molecular Formula | C26H20N4O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]acetamide |
| SMILES | Cc1ccc2nc(COc3ccc(NC(=O)CN4C(=O)c5ccccc5C4=O)cc3)cc(=O)n2c1 |
| InChI | InChI=1S/C26H20N4O5/c1-16-6-11-22-27-18(12-24(32)29(22)13-16)15-35-19-9-7-17(8-10-19)28-23(31)14-30-25(33)20-4-2-3-5-21(20)26(30)34/h2-13H,14-15H2,1H3,(H,28,31) |
| InChIKey | NETQPECJRSETDD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|