C24H20ClN3OS — CID 46357700
2-[3-[(4-chlorophenyl)methyl]quinoxalin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide (PubChem CID 46357700) has the molecular formula C24H20ClN3OS and a molecular weight of 433.96 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]quinoxalin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]quinoxalin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 46357700 |
| Molecular Formula | C24H20ClN3OS |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]quinoxalin-2-yl]sulfanyl-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ccccc3nc2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20ClN3OS/c1-16-6-12-19(13-7-16)26-23(29)15-30-24-22(14-17-8-10-18(25)11-9-17)27-20-4-2-3-5-21(20)28-24/h2-13H,14-15H2,1H3,(H,26,29) |
| InChIKey | VUXUWXJRVVGXFR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |