C24H19FN4O2S — CID 118418598
2-(3-benzylquinoxalin-2-yl)sulfanyl-N-[(4-fluorophenyl)carbamoyl]acetamide (PubChem CID 118418598) has the molecular formula C24H19FN4O2S and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-(3-benzylquinoxalin-2-yl)sulfanyl-N-[(4-fluorophenyl)carbamoyl]acetamide.
| Compound Name | 2-(3-benzylquinoxalin-2-yl)sulfanyl-N-[(4-fluorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 118418598 |
| Molecular Formula | C24H19FN4O2S |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-(3-benzylquinoxalin-2-yl)sulfanyl-N-[(4-fluorophenyl)carbamoyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2nc1Cc1ccccc1)NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN4O2S/c25-17-10-12-18(13-11-17)26-24(31)29-22(30)15-32-23-21(14-16-6-2-1-3-7-16)27-19-8-4-5-9-20(19)28-23/h1-13H,14-15H2,(H2,26,29,30,31) |
| InChIKey | AIKSEEHGHQJALE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |