C22H17N3O2S — CID 12840972
2-acridin-9-ylsulfanyl-N-(phenylcarbamoyl)acetamide (PubChem CID 12840972) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-acridin-9-ylsulfanyl-N-(phenylcarbamoyl)acetamide.
| Compound Name | 2-acridin-9-ylsulfanyl-N-(phenylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 12840972 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-acridin-9-ylsulfanyl-N-(phenylcarbamoyl)acetamide |
| SMILES | O=C(CSc1c2ccccc2nc2ccccc12)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H17N3O2S/c26-20(25-22(27)23-15-8-2-1-3-9-15)14-28-21-16-10-4-6-12-18(16)24-19-13-7-5-11-17(19)21/h1-13H,14H2,(H2,23,25,26,27) |
| InChIKey | BTHGHRCXIWMODU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|