C25H29N5O2 — CID 46358544
1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(3-methylphenyl)piperidine-4-carboxamide (PubChem CID 46358544) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(3-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(3-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46358544 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(3-methylphenyl)piperidine-4-carboxamide |
| SMILES | CC(=O)Nc1c(C)nn(-c2ccccc2)c1N1CCC(C(=O)Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C25H29N5O2/c1-17-8-7-9-21(16-17)27-24(32)20-12-14-29(15-13-20)25-23(26-19(3)31)18(2)28-30(25)22-10-5-4-6-11-22/h4-11,16,20H,12-15H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | GDLCBXRYGTZYQX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |