C26H31N5O2 — CID 46358506
1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(1-phenylethyl)piperidine-4-carboxamide (PubChem CID 46358506) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(1-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(1-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46358506 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 1-(4-acetamido-3-methyl-1-phenylpyrazol-5-yl)-N-(1-phenylethyl)piperidine-4-carboxamide |
| SMILES | CC(=O)Nc1c(C)nn(-c2ccccc2)c1N1CCC(C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N5O2/c1-18(21-10-6-4-7-11-21)27-25(33)22-14-16-30(17-15-22)26-24(28-20(3)32)19(2)29-31(26)23-12-8-5-9-13-23/h4-13,18,22H,14-17H2,1-3H3,(H,27,33)(H,28,32) |
| InChIKey | PGJBCSGHPZSZGS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |