C22H29N5O — CID 53146134
N-(1-phenylethyl)-1-(2-pyrrolidin-1-ylpyrimidin-5-yl)piperidine-4-carboxamide (PubChem CID 53146134) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(1-phenylethyl)-1-(2-pyrrolidin-1-ylpyrimidin-5-yl)piperidine-4-carboxamide.
| Compound Name | N-(1-phenylethyl)-1-(2-pyrrolidin-1-ylpyrimidin-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53146134 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-(1-phenylethyl)-1-(2-pyrrolidin-1-ylpyrimidin-5-yl)piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(c2cnc(N3CCCC3)nc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H29N5O/c1-17(18-7-3-2-4-8-18)25-21(28)19-9-13-26(14-10-19)20-15-23-22(24-16-20)27-11-5-6-12-27/h2-4,7-8,15-17,19H,5-6,9-14H2,1H3,(H,25,28) |
| InChIKey | COSMJOBWTGROQJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |