C25H28N4O2 — CID 95114431
1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide (PubChem CID 95114431) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide.
| Compound Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95114431 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCN(c2cnn(Cc3ccccc3)c(=O)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O2/c1-19(21-10-6-3-7-11-21)27-25(31)22-12-14-28(15-13-22)23-16-24(30)29(26-17-23)18-20-8-4-2-5-9-20/h2-11,16-17,19,22H,12-15,18H2,1H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | GWNWNJGXOZJARR-LJQANCHMSA-N |
| XLogP | 3.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |