C16H17N3O3 — CID 122048542
1-(1-benzyl-6-oxopyridazin-4-yl)pyrrolidine-3-carboxylic acid (PubChem CID 122048542) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(1-benzyl-6-oxopyridazin-4-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(1-benzyl-6-oxopyridazin-4-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122048542 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-(1-benzyl-6-oxopyridazin-4-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cnn(Cc3ccccc3)c(=O)c2)C1 |
| InChI | InChI=1S/C16H17N3O3/c20-15-8-14(18-7-6-13(11-18)16(21)22)9-17-19(15)10-12-4-2-1-3-5-12/h1-5,8-9,13H,6-7,10-11H2,(H,21,22) |
| InChIKey | OFRDEOAJYJHAPV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |