C20H20FN3O3 — CID 46358776
methyl 5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-fluorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 46358776) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is methyl 5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-fluorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-fluorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 46358776 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl 5-[[4-(dimethylamino)phenyl]methylamino]-3-(4-fluorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)noc1NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H20FN3O3/c1-24(2)16-10-4-13(5-11-16)12-22-19-17(20(25)26-3)18(23-27-19)14-6-8-15(21)9-7-14/h4-11,22H,12H2,1-3H3 |
| InChIKey | KZAVMRVRVNDZPL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|