C21H23BrN4O2 — CID 46359100
1-(6-bromo-1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 46359100) has the molecular formula C21H23BrN4O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is 1-(6-bromo-1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(6-bromo-1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46359100 |
| Molecular Formula | C21H23BrN4O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-(6-bromo-1H-benzimidazol-2-yl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)C1CCCN(c2nc3ccc(Br)cc3[nH]2)C1 |
| InChI | InChI=1S/C21H23BrN4O2/c1-28-19-7-3-2-5-14(19)12-23-20(27)15-6-4-10-26(13-15)21-24-17-9-8-16(22)11-18(17)25-21/h2-3,5,7-9,11,15H,4,6,10,12-13H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | VXWKSBQNGSDZTM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |