C17H23BrN4O — CID 92876535
(3S)-1-(6-bromo-1H-benzimidazol-2-yl)-N-butylpiperidine-3-carboxamide (PubChem CID 92876535) has the molecular formula C17H23BrN4O and a molecular weight of 379.30 g/mol. Its IUPAC name is (3S)-1-(6-bromo-1H-benzimidazol-2-yl)-N-butylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(6-bromo-1H-benzimidazol-2-yl)-N-butylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92876535 |
| Molecular Formula | C17H23BrN4O |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (3S)-1-(6-bromo-1H-benzimidazol-2-yl)-N-butylpiperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CCCN(c2nc3ccc(Br)cc3[nH]2)C1 |
| InChI | InChI=1S/C17H23BrN4O/c1-2-3-8-19-16(23)12-5-4-9-22(11-12)17-20-14-7-6-13(18)10-15(14)21-17/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,19,23)(H,20,21)/t12-/m0/s1 |
| InChIKey | OVXGGJVWQQKRRV-LBPRGKRZSA-N |
| XLogP | 3.46 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|