C23H28N4O3 — CID 46365153
N-(2,5-diethoxyphenyl)-3-(diethylamino)quinoxaline-2-carboxamide (PubChem CID 46365153) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-3-(diethylamino)quinoxaline-2-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-3-(diethylamino)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46365153 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-3-(diethylamino)quinoxaline-2-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2nc3ccccc3nc2N(CC)CC)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-5-27(6-2)22-21(24-17-11-9-10-12-18(17)25-22)23(28)26-19-15-16(29-7-3)13-14-20(19)30-8-4/h9-15H,5-8H2,1-4H3,(H,26,28) |
| InChIKey | IQRBHZTUNQJXLT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |