C23H27N3O4 — CID 50765373
2-methylpropyl 3-(2,5-diethoxyanilino)quinoxaline-2-carboxylate (PubChem CID 50765373) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-methylpropyl 3-(2,5-diethoxyanilino)quinoxaline-2-carboxylate.
| Compound Name | 2-methylpropyl 3-(2,5-diethoxyanilino)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 50765373 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-methylpropyl 3-(2,5-diethoxyanilino)quinoxaline-2-carboxylate |
| SMILES | CCOc1ccc(OCC)c(Nc2nc3ccccc3nc2C(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-5-28-16-11-12-20(29-6-2)19(13-16)26-22-21(23(27)30-14-15(3)4)24-17-9-7-8-10-18(17)25-22/h7-13,15H,5-6,14H2,1-4H3,(H,25,26) |
| InChIKey | OQJBZOVNNBOONZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |